C14H20N2O4 — CID 110671038
(2-methoxyphenyl) 2-(tert-butylcarbamoylamino)acetate (PubChem CID 110671038) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2-methoxyphenyl) 2-(tert-butylcarbamoylamino)acetate.
| Compound Name | (2-methoxyphenyl) 2-(tert-butylcarbamoylamino)acetate |
|---|---|
| PubChem CID | 110671038 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (2-methoxyphenyl) 2-(tert-butylcarbamoylamino)acetate |
| SMILES | COc1ccccc1OC(=O)CNC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H20N2O4/c1-14(2,3)16-13(18)15-9-12(17)20-11-8-6-5-7-10(11)19-4/h5-8H,9H2,1-4H3,(H2,15,16,18) |
| InChIKey | ZJGJITZCAVZOHU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|