C10H9FN2O2 — CID 58777394
(2-cyano-5-fluorophenyl) N,N-dimethylcarbamate (PubChem CID 58777394) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is (2-cyano-5-fluorophenyl) N,N-dimethylcarbamate.
| Compound Name | (2-cyano-5-fluorophenyl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 58777394 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (2-cyano-5-fluorophenyl) N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cc(F)ccc1C#N |
| InChI | InChI=1S/C10H9FN2O2/c1-13(2)10(14)15-9-5-8(11)4-3-7(9)6-12/h3-5H,1-2H3 |
| InChIKey | BRGRFBNYNBYRLV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |