C19H20FN3O2 — CID 39959751
2-(2-cyanophenoxy)-N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]acetamide (PubChem CID 39959751) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 39959751 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[(2S)-2-(dimethylamino)-2-(3-fluorophenyl)ethyl]acetamide |
| SMILES | CN(C)[C@H](CNC(=O)COc1ccccc1C#N)c1cccc(F)c1 |
| InChI | InChI=1S/C19H20FN3O2/c1-23(2)17(14-7-5-8-16(20)10-14)12-22-19(24)13-25-18-9-4-3-6-15(18)11-21/h3-10,17H,12-13H2,1-2H3,(H,22,24)/t17-/m1/s1 |
| InChIKey | JMLVOUOQROPLLL-QGZVFWFLSA-N |
| XLogP | 2.50 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |