C28H31FN2O8S2 — CID 88641826
(4-nitrophenyl)methyl 3-(2,2-dimethylpropanoylsulfanyl)-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-3-(3-fluorophenoxy)prop-2-enoate (PubChem CID 88641826) has the molecular formula C28H31FN2O8S2 and a molecular weight of 606.69 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-(2,2-dimethylpropanoylsulfanyl)-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-3-(3-fluorophenoxy)prop-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 3-(2,2-dimethylpropanoylsulfanyl)-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-3-(3-fluorophenoxy)prop-2-enoate |
|---|---|
| PubChem CID | 88641826 |
| Molecular Formula | C28H31FN2O8S2 |
| Molecular Weight | 606.69 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | (4-nitrophenyl)methyl 3-(2,2-dimethylpropanoylsulfanyl)-2-[(2R,3S)-2-ethylsulfanyl-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-1-yl]-3-(3-fluorophenoxy)prop-2-enoate |
| SMILES | CCS[C@@H]1[C@@H]([C@@H](C)O)C(=O)N1C(C(=O)OCc1ccc([N+](=O)[O-])cc1)=C(Oc1cccc(F)c1)SC(=O)C(C)(C)C |
| InChI | InChI=1S/C28H31FN2O8S2/c1-6-40-24-21(16(2)32)23(33)30(24)22(25(34)38-15-17-10-12-19(13-11-17)31(36)37)26(41-27(35)28(3,4)5)39-20-9-7-8-18(29)14-20/h7-14,16,21,24,32H,6,15H2,1-5H3/t16-,21+,24-/m1/s1 |
| InChIKey | CJASYIQVZGEIQF-FBJLLXQBSA-N |
| XLogP | 5.25 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.69 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|