C30H37N3O6S3Si — CID 88675034
(4-nitrophenyl)methyl 2-[(3R)-3-(1,3-benzothiazol-4-yldisulfanyl)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 88675034) has the molecular formula C30H37N3O6S3Si and a molecular weight of 659.93 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(3R)-3-(1,3-benzothiazol-4-yldisulfanyl)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxoazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 2-[(3R)-3-(1,3-benzothiazol-4-yldisulfanyl)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxoazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 88675034 |
| Molecular Formula | C30H37N3O6S3Si |
| Molecular Weight | 659.93 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(3R)-3-(1,3-benzothiazol-4-yldisulfanyl)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | CC(C)=C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C[C@@](SSc2cccc3scnc23)([C@@H](C)O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C30H37N3O6S3Si/c1-19(2)26(27(34)38-16-21-12-14-22(15-13-21)33(36)37)32-17-30(28(32)35,20(3)39-43(7,8)29(4,5)6)42-41-24-11-9-10-23-25(24)31-18-40-23/h9-15,18,20H,16-17H2,1-8H3/t20-,30-/m1/s1 |
| InChIKey | SJXVUILZEQAXRR-PRAQEBQASA-N |
| XLogP | 7.97 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.93 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|