C41H47BrNO4PSSi — CID 19851487
prop-2-enyl 2-[3-[4-(bromomethyl)phenyl]sulfanyl-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 19851487) has the molecular formula C41H47BrNO4PSSi and a molecular weight of 788.86 g/mol. Its IUPAC name is prop-2-enyl 2-[3-[4-(bromomethyl)phenyl]sulfanyl-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | prop-2-enyl 2-[3-[4-(bromomethyl)phenyl]sulfanyl-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 19851487 |
| Molecular Formula | C41H47BrNO4PSSi |
| Molecular Weight | 788.86 g/mol |
| Exact Mass | 787.19 |
| IUPAC Name | prop-2-enyl 2-[3-[4-(bromomethyl)phenyl]sulfanyl-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | C=CCOC(=O)C(N1CC(Sc2ccc(CBr)cc2)(C(C)O[Si](C)(C)C(C)(C)C)C1=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H47BrNO4PSSi/c1-8-28-46-38(44)37(48(33-18-12-9-13-19-33,34-20-14-10-15-21-34)35-22-16-11-17-23-35)43-30-41(39(43)45,31(2)47-50(6,7)40(3,4)5)49-36-26-24-32(29-42)25-27-36/h8-27,31H,1,28-30H2,2-7H3 |
| InChIKey | YFTJLEMAWSDIFU-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.86 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|