C36H44NO5PSSi — CID 88506877
prop-2-enyl 2-[(3S)-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxybutanoyl]sulfanyl-2-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 88506877) has the molecular formula C36H44NO5PSSi and a molecular weight of 661.88 g/mol. Its IUPAC name is prop-2-enyl 2-[(3S)-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxybutanoyl]sulfanyl-2-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | prop-2-enyl 2-[(3S)-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxybutanoyl]sulfanyl-2-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 88506877 |
| Molecular Formula | C36H44NO5PSSi |
| Molecular Weight | 661.88 g/mol |
| Exact Mass | 661.24 |
| IUPAC Name | prop-2-enyl 2-[(3S)-3-[(3R)-3-[tert-butyl(dimethyl)silyl]oxybutanoyl]sulfanyl-2-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | C=CCOC(=O)C(N1C[C@H](SC(=O)C[C@@H](C)O[Si](C)(C)C(C)(C)C)C1=O)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H44NO5PSSi/c1-8-24-41-35(40)34(37-26-31(33(37)39)44-32(38)25-27(2)42-45(6,7)36(3,4)5)43(28-18-12-9-13-19-28,29-20-14-10-15-21-29)30-22-16-11-17-23-30/h8-23,27,31H,1,24-26H2,2-7H3/t27-,31+/m1/s1 |
| InChIKey | HHBNWSCJFVDTGM-JOMNFKBKSA-N |
| XLogP | 6.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.88 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|