C42H36N3O11PS — CID 18596538
(4-nitrophenyl)methyl 2-[(2R,3S)-2-(2-hydroxyacetyl)-3-[2-[(4-nitrophenyl)methoxycarbonylsulfanyl]ethyl]-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 18596538) has the molecular formula C42H36N3O11PS and a molecular weight of 821.80 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2R,3S)-2-(2-hydroxyacetyl)-3-[2-[(4-nitrophenyl)methoxycarbonylsulfanyl]ethyl]-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2R,3S)-2-(2-hydroxyacetyl)-3-[2-[(4-nitrophenyl)methoxycarbonylsulfanyl]ethyl]-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 18596538 |
| Molecular Formula | C42H36N3O11PS |
| Molecular Weight | 821.80 g/mol |
| Exact Mass | 821.18 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2R,3S)-2-(2-hydroxyacetyl)-3-[2-[(4-nitrophenyl)methoxycarbonylsulfanyl]ethyl]-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)SCC[C@@H]1C(=O)N(C(C(=O)OCc2ccc([N+](=O)[O-])cc2)=P(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1C(=O)CO |
| InChI | InChI=1S/C42H36N3O11PS/c46-26-37(47)38-36(24-25-58-42(50)56-28-30-18-22-32(23-19-30)45(53)54)39(48)43(38)40(41(49)55-27-29-16-20-31(21-17-29)44(51)52)57(33-10-4-1-5-11-33,34-12-6-2-7-13-34)35-14-8-3-9-15-35/h1-23,36,38,46H,24-28H2/t36-,38+/m0/s1 |
| InChIKey | YEFXYJNITCVPAX-KLESUSOLSA-N |
| XLogP | 5.52 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.80 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|