C36H30N3O3PS — CID 20545059
benzyl 2-[2-oxo-4-(2-pyrimidin-2-yl-2-sulfanylideneethyl)azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 20545059) has the molecular formula C36H30N3O3PS and a molecular weight of 615.70 g/mol. Its IUPAC name is benzyl 2-[2-oxo-4-(2-pyrimidin-2-yl-2-sulfanylideneethyl)azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | benzyl 2-[2-oxo-4-(2-pyrimidin-2-yl-2-sulfanylideneethyl)azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 20545059 |
| Molecular Formula | C36H30N3O3PS |
| Molecular Weight | 615.70 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | benzyl 2-[2-oxo-4-(2-pyrimidin-2-yl-2-sulfanylideneethyl)azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | O=C(OCc1ccccc1)C(N1C(=O)CC1CC(=S)c1ncccn1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H30N3O3PS/c40-33-25-28(24-32(44)34-37-22-13-23-38-34)39(33)35(36(41)42-26-27-14-5-1-6-15-27)43(29-16-7-2-8-17-29,30-18-9-3-10-19-30)31-20-11-4-12-21-31/h1-23,28H,24-26H2 |
| InChIKey | OQPJICZWQYQFRA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|