C36H31N2O5PS — CID 173434949
benzyl 2-[2-(4-isocyanato-4-methoxy-2-sulfanylidenebut-3-enyl)-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 173434949) has the molecular formula C36H31N2O5PS and a molecular weight of 634.69 g/mol. Its IUPAC name is benzyl 2-[2-(4-isocyanato-4-methoxy-2-sulfanylidenebut-3-enyl)-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | benzyl 2-[2-(4-isocyanato-4-methoxy-2-sulfanylidenebut-3-enyl)-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 173434949 |
| Molecular Formula | C36H31N2O5PS |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | benzyl 2-[2-(4-isocyanato-4-methoxy-2-sulfanylidenebut-3-enyl)-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | COC(=CC(=S)CC1CC(=O)N1C(C(=O)OCc1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1)N=C=O |
| InChI | InChI=1S/C36H31N2O5PS/c1-42-33(37-26-39)24-32(45)22-28-23-34(40)38(28)35(36(41)43-25-27-14-6-2-7-15-27)44(29-16-8-3-9-17-29,30-18-10-4-11-19-30)31-20-12-5-13-21-31/h2-21,24,28H,22-23,25H2,1H3 |
| InChIKey | KCTVLTSRWIGQSC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|