C36H36NO4P — CID 54112582
benzyl 2-[(3S,4S)-3-(2-hydroxypropan-2-yl)-2-oxo-4-prop-2-enylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 54112582) has the molecular formula C36H36NO4P and a molecular weight of 577.66 g/mol. Its IUPAC name is benzyl 2-[(3S,4S)-3-(2-hydroxypropan-2-yl)-2-oxo-4-prop-2-enylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | benzyl 2-[(3S,4S)-3-(2-hydroxypropan-2-yl)-2-oxo-4-prop-2-enylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 54112582 |
| Molecular Formula | C36H36NO4P |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | benzyl 2-[(3S,4S)-3-(2-hydroxypropan-2-yl)-2-oxo-4-prop-2-enylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | C=CC[C@H]1[C@@H](C(C)(C)O)C(=O)N1C(C(=O)OCc1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H36NO4P/c1-4-17-31-32(36(2,3)40)33(38)37(31)34(35(39)41-26-27-18-9-5-10-19-27)42(28-20-11-6-12-21-28,29-22-13-7-14-23-29)30-24-15-8-16-25-30/h4-16,18-25,31-32,40H,1,17,26H2,2-3H3/t31-,32+/m0/s1 |
| InChIKey | NIDDINZPBRIPLZ-AJQTZOPKSA-N |
| XLogP | 5.03 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|