About benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate
benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate (PubChem CID 101206665) has the molecular formula C29H25O3P
and a molecular weight of 452.49 g/mol. Its IUPAC name is benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate.
Molecular Properties
| Compound Name | benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate |
| PubChem CID | 101206665 |
| Molecular Formula | C29H25O3P |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate |
| SMILES | C=C(O)C(C(=O)OCc1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H25O3P/c1-23(30)28(29(31)32-22-24-14-6-2-7-15-24)33(25-16-8-3-9-17-25,26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21,30H,1,22H2 |
| InChIKey | PQZFGVFYHLIULJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate?
The IUPAC name of benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate (CID 101206665) is benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate.
What is the SMILES notation for benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate?
The canonical SMILES for benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate is C=C(O)C(C(=O)OCc1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate?
The InChIKey is PQZFGVFYHLIULJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25O3P/c1-23(30)28(29(31)32-22-24-14-6-2-7-15-24)33(25-16-8-3-9-17-25,26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21,30H,1,22H2.
What are the key properties of benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate?
benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate has a molecular weight of 452.49 g/mol, XLogP of 4.97, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-hydroxy-2-(triphenyl-λ5-phosphanylidene)but-3-enoate is sourced from PubChem (CID 101206665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).