C39H39N2O5P — CID 58844289
prop-2-enyl 2-[(2R,3R)-2-[2-[4-(formamidomethyl)phenyl]-2-oxoethyl]-4-oxo-3-propan-2-ylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 58844289) has the molecular formula C39H39N2O5P and a molecular weight of 646.72 g/mol. Its IUPAC name is prop-2-enyl 2-[(2R,3R)-2-[2-[4-(formamidomethyl)phenyl]-2-oxoethyl]-4-oxo-3-propan-2-ylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | prop-2-enyl 2-[(2R,3R)-2-[2-[4-(formamidomethyl)phenyl]-2-oxoethyl]-4-oxo-3-propan-2-ylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 58844289 |
| Molecular Formula | C39H39N2O5P |
| Molecular Weight | 646.72 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | prop-2-enyl 2-[(2R,3R)-2-[2-[4-(formamidomethyl)phenyl]-2-oxoethyl]-4-oxo-3-propan-2-ylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | C=CCOC(=O)C(N1C(=O)[C@H](C(C)C)[C@H]1CC(=O)c1ccc(CNC=O)cc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H39N2O5P/c1-4-24-46-39(45)38(47(31-14-8-5-9-15-31,32-16-10-6-11-17-32)33-18-12-7-13-19-33)41-34(36(28(2)3)37(41)44)25-35(43)30-22-20-29(21-23-30)26-40-27-42/h4-23,27-28,34,36H,1,24-26H2,2-3H3,(H,40,42)/t34-,36-/m1/s1 |
| InChIKey | CXLNPHDEEZVDSC-QZCRLSDHSA-N |
| XLogP | 4.84 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.72 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|