C39H39N2O5PS — CID 88771169
benzyl 2-[(2S)-2-(1-acetamido-2-sulfanylidenebut-3-enyl)-3-(2-hydroxypropan-2-yl)-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 88771169) has the molecular formula C39H39N2O5PS and a molecular weight of 678.79 g/mol. Its IUPAC name is benzyl 2-[(2S)-2-(1-acetamido-2-sulfanylidenebut-3-enyl)-3-(2-hydroxypropan-2-yl)-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | benzyl 2-[(2S)-2-(1-acetamido-2-sulfanylidenebut-3-enyl)-3-(2-hydroxypropan-2-yl)-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 88771169 |
| Molecular Formula | C39H39N2O5PS |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | benzyl 2-[(2S)-2-(1-acetamido-2-sulfanylidenebut-3-enyl)-3-(2-hydroxypropan-2-yl)-4-oxoazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | C=CC(=S)C(NC(C)=O)[C@@H]1C(C(C)(C)O)C(=O)N1C(C(=O)OCc1ccccc1)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H39N2O5PS/c1-5-32(48)34(40-27(2)42)35-33(39(3,4)45)36(43)41(35)37(38(44)46-26-28-18-10-6-11-19-28)47(29-20-12-7-13-21-29,30-22-14-8-15-23-30)31-24-16-9-17-25-31/h5-25,33-35,45H,1,26H2,2-4H3,(H,40,42)/t33?,34?,35-/m0/s1 |
| InChIKey | RPQHCYDLYGKZSH-YLNHBKTGSA-N |
| XLogP | 4.51 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|