C51H46NO6PS — CID 56614977
prop-2-enyl 2-[(3S,4R)-2-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-4-tritylsulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 56614977) has the molecular formula C51H46NO6PS and a molecular weight of 831.97 g/mol. Its IUPAC name is prop-2-enyl 2-[(3S,4R)-2-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-4-tritylsulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | prop-2-enyl 2-[(3S,4R)-2-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-4-tritylsulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 56614977 |
| Molecular Formula | C51H46NO6PS |
| Molecular Weight | 831.97 g/mol |
| Exact Mass | 831.28 |
| IUPAC Name | prop-2-enyl 2-[(3S,4R)-2-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-4-tritylsulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | C=CCOC(=O)O[C@H](C)[C@H]1C(=O)N(C(C(=O)OCC=C)=P(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C51H46NO6PS/c1-4-36-56-49(54)47(59(42-30-18-9-19-31-42,43-32-20-10-21-33-43)44-34-22-11-23-35-44)52-46(53)45(38(3)58-50(55)57-37-5-2)48(52)60-51(39-24-12-6-13-25-39,40-26-14-7-15-27-40)41-28-16-8-17-29-41/h4-35,38,45,48H,1-2,36-37H2,3H3/t38-,45+,48-/m1/s1 |
| InChIKey | SFKXAULIKBIXMF-WVWNVUKASA-N |
| XLogP | 9.08 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.97 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|