C38H40N5O7PS — CID 57167317
prop-2-enyl 2-[(3S,4R)-2-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-4-[5-(tetrazol-1-yl)pentanoylsulfanyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 57167317) has the molecular formula C38H40N5O7PS and a molecular weight of 741.81 g/mol. Its IUPAC name is prop-2-enyl 2-[(3S,4R)-2-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-4-[5-(tetrazol-1-yl)pentanoylsulfanyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | prop-2-enyl 2-[(3S,4R)-2-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-4-[5-(tetrazol-1-yl)pentanoylsulfanyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 57167317 |
| Molecular Formula | C38H40N5O7PS |
| Molecular Weight | 741.81 g/mol |
| Exact Mass | 741.24 |
| IUPAC Name | prop-2-enyl 2-[(3S,4R)-2-oxo-3-[(1R)-1-prop-2-enoxycarbonyloxyethyl]-4-[5-(tetrazol-1-yl)pentanoylsulfanyl]azetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | C=CCOC(=O)O[C@H](C)[C@H]1C(=O)N(C(C(=O)OCC=C)=P(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H]1SC(=O)CCCCn1cnnn1 |
| InChI | InChI=1S/C38H40N5O7PS/c1-4-25-48-37(46)35(51(29-17-9-6-10-18-29,30-19-11-7-12-20-30)31-21-13-8-14-22-31)43-34(45)33(28(3)50-38(47)49-26-5-2)36(43)52-32(44)23-15-16-24-42-27-39-40-41-42/h4-14,17-22,27-28,33,36H,1-2,15-16,23-26H2,3H3/t28-,33+,36-/m1/s1 |
| InChIKey | KYIOMENGEHBOJE-UZSORJTLSA-N |
| XLogP | 4.47 |
| TPSA | 142.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.81 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|