C33H42ClN2O11PS — CID 88672417
(4-nitrophenyl)methyl 2-[3-[1-(2-chloroacetyl)oxyethyl]-2-oxo-4-(2-oxo-2-phenylsulfanylethyl)azetidin-1-yl]-2-[tri(propan-2-yloxy)-λ5-phosphanylidene]acetate (PubChem CID 88672417) has the molecular formula C33H42ClN2O11PS and a molecular weight of 741.20 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[3-[1-(2-chloroacetyl)oxyethyl]-2-oxo-4-(2-oxo-2-phenylsulfanylethyl)azetidin-1-yl]-2-[tri(propan-2-yloxy)-λ5-phosphanylidene]acetate.
| Compound Name | (4-nitrophenyl)methyl 2-[3-[1-(2-chloroacetyl)oxyethyl]-2-oxo-4-(2-oxo-2-phenylsulfanylethyl)azetidin-1-yl]-2-[tri(propan-2-yloxy)-λ5-phosphanylidene]acetate |
|---|---|
| PubChem CID | 88672417 |
| Molecular Formula | C33H42ClN2O11PS |
| Molecular Weight | 741.20 g/mol |
| Exact Mass | 740.19 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[3-[1-(2-chloroacetyl)oxyethyl]-2-oxo-4-(2-oxo-2-phenylsulfanylethyl)azetidin-1-yl]-2-[tri(propan-2-yloxy)-λ5-phosphanylidene]acetate |
| SMILES | CC(C)OP(OC(C)C)(OC(C)C)=C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C(C(C)OC(=O)CCl)C1CC(=O)Sc1ccccc1 |
| InChI | InChI=1S/C33H42ClN2O11PS/c1-20(2)45-48(46-21(3)4,47-22(5)6)32(33(40)43-19-24-13-15-25(16-14-24)36(41)42)35-27(17-29(38)49-26-11-9-8-10-12-26)30(31(35)39)23(7)44-28(37)18-34/h8-16,20-23,27,30H,17-19H2,1-7H3 |
| InChIKey | QEILCQPCBWUQSV-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 160.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.20 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|