C33H29BrN4O6S — CID 139772229
(4-nitrophenyl)methyl (2S,3R,5R,6R)-7-oxo-6-[(2-phenylacetyl)amino]-3-[4-(pyridin-1-ium-1-ylmethyl)phenyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate bromide (PubChem CID 139772229) has the molecular formula C33H29BrN4O6S and a molecular weight of 689.59 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2S,3R,5R,6R)-7-oxo-6-[(2-phenylacetyl)amino]-3-[4-(pyridin-1-ium-1-ylmethyl)phenyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate bromide.
| Compound Name | (4-nitrophenyl)methyl (2S,3R,5R,6R)-7-oxo-6-[(2-phenylacetyl)amino]-3-[4-(pyridin-1-ium-1-ylmethyl)phenyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate bromide |
|---|---|
| PubChem CID | 139772229 |
| Molecular Formula | C33H29BrN4O6S |
| Molecular Weight | 689.59 g/mol |
| Exact Mass | 688.10 |
| IUPAC Name | (4-nitrophenyl)methyl (2S,3R,5R,6R)-7-oxo-6-[(2-phenylacetyl)amino]-3-[4-(pyridin-1-ium-1-ylmethyl)phenyl]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate bromide |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C(=O)N2[C@@H]1S[C@H](c1ccc(C[n+]3ccccc3)cc1)[C@@H]2C(=O)OCc1ccc([N+](=O)[O-])cc1.[Br-] |
| InChI | InChI=1S/C33H28N4O6S.BrH/c38-27(19-22-7-3-1-4-8-22)34-28-31(39)36-29(33(40)43-21-24-11-15-26(16-12-24)37(41)42)30(44-32(28)36)25-13-9-23(10-14-25)20-35-17-5-2-6-18-35;/h1-18,28-30,32H,19-21H2;1H/t28-,29-,30-,32-;/m1./s1 |
| InChIKey | RQWQOISJHCKBOO-XWPLYICLSA-N |
| XLogP | 0.73 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.59 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|