C26H24FN3O7S — CID 131716297
benzhydryl 2-[(4S)-4-[[(Z)-2-carbamoyl-4-fluorobut-3-enethioyl]amino]-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate (PubChem CID 131716297) has the molecular formula C26H24FN3O7S and a molecular weight of 541.56 g/mol. Its IUPAC name is benzhydryl 2-[(4S)-4-[[(Z)-2-carbamoyl-4-fluorobut-3-enethioyl]amino]-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate.
| Compound Name | benzhydryl 2-[(4S)-4-[[(Z)-2-carbamoyl-4-fluorobut-3-enethioyl]amino]-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate |
|---|---|
| PubChem CID | 131716297 |
| Molecular Formula | C26H24FN3O7S |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | benzhydryl 2-[(4S)-4-[[(Z)-2-carbamoyl-4-fluorobut-3-enethioyl]amino]-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate |
| SMILES | NC(=O)C(/C=C\F)C(=S)N[C@H]1CON(C2(C(=O)OC(c3ccccc3)c3ccccc3)CCC(=O)O2)C1=O |
| InChI | InChI=1S/C26H24FN3O7S/c27-14-12-18(22(28)32)23(38)29-19-15-35-30(24(19)33)26(13-11-20(31)37-26)25(34)36-21(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,12,14,18-19,21H,11,13,15H2,(H2,28,32)(H,29,38)/b14-12-/t18?,19-,26?/m0/s1 |
| InChIKey | YUDSURWCBKIYPN-IRDXDURLSA-N |
| XLogP | 2.00 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|