C26H23N3O6S — CID 88666034
benzhydryl 2-[(4S)-4-(3-cyanobut-3-enethioylamino)-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate (PubChem CID 88666034) has the molecular formula C26H23N3O6S and a molecular weight of 505.55 g/mol. Its IUPAC name is benzhydryl 2-[(4S)-4-(3-cyanobut-3-enethioylamino)-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate.
| Compound Name | benzhydryl 2-[(4S)-4-(3-cyanobut-3-enethioylamino)-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate |
|---|---|
| PubChem CID | 88666034 |
| Molecular Formula | C26H23N3O6S |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | benzhydryl 2-[(4S)-4-(3-cyanobut-3-enethioylamino)-3-oxo-1,2-oxazolidin-2-yl]-5-oxooxolane-2-carboxylate |
| SMILES | C=C(C#N)CC(=S)N[C@H]1CON(C2(C(=O)OC(c3ccccc3)c3ccccc3)CCC(=O)O2)C1=O |
| InChI | InChI=1S/C26H23N3O6S/c1-17(15-27)14-21(36)28-20-16-33-29(24(20)31)26(13-12-22(30)35-26)25(32)34-23(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,20,23H,1,12-14,16H2,(H,28,36)/t20-,26?/m0/s1 |
| InChIKey | YKULTLKHSYSEOG-DQUNLGLBSA-N |
| XLogP | 2.88 |
| TPSA | 117.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|