C29H25N3O10S — CID 67902342
(4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]-3-phenylsulfanyloxolane-2-carboxylate (PubChem CID 67902342) has the molecular formula C29H25N3O10S and a molecular weight of 607.60 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]-3-phenylsulfanyloxolane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]-3-phenylsulfanyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 67902342 |
| Molecular Formula | C29H25N3O10S |
| Molecular Weight | 607.60 g/mol |
| Exact Mass | 607.13 |
| IUPAC Name | (4-nitrophenyl)methyl 5-oxo-2-[(4S)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl]-3-phenylsulfanyloxolane-2-carboxylate |
| SMILES | O=C1CC(Sc2ccccc2)C(C(=O)OCc2ccc([N+](=O)[O-])cc2)(N2OC[C@H](NC(=O)OCc3ccccc3)C2=O)O1 |
| InChI | InChI=1S/C29H25N3O10S/c33-25-15-24(43-22-9-5-2-6-10-22)29(42-25,27(35)39-16-20-11-13-21(14-12-20)32(37)38)31-26(34)23(18-41-31)30-28(36)40-17-19-7-3-1-4-8-19/h1-14,23-24H,15-18H2,(H,30,36)/t23-,24?,29?/m0/s1 |
| InChIKey | COBQMNITGJZWNV-ROQQUUPQSA-N |
| XLogP | 3.51 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|