About [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate
[(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate (PubChem CID 57324356) has the molecular formula C16H16N2O8
and a molecular weight of 364.31 g/mol. Its IUPAC name is [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate.
Molecular Properties
| Compound Name | [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate |
| PubChem CID | 57324356 |
| Molecular Formula | C16H16N2O8 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate |
| SMILES | O=C1CCC(C(=O)ON2OC[C@@H](NC(=O)OCc3ccccc3)C2=O)O1 |
| InChI | InChI=1S/C16H16N2O8/c19-13-7-6-12(25-13)15(21)26-18-14(20)11(9-24-18)17-16(22)23-8-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,17,22)/t11-,12?/m1/s1 |
| InChIKey | FVUFUTOYEFHGGR-JHJMLUEUSA-N |
| XLogP | 0.22 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate?
The IUPAC name of [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate (CID 57324356) is [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate.
What is the SMILES notation for [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate?
The canonical SMILES for [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate is O=C1CCC(C(=O)ON2OC[C@@H](NC(=O)OCc3ccccc3)C2=O)O1.
What is the InChIKey of [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate?
The InChIKey is FVUFUTOYEFHGGR-JHJMLUEUSA-N. The full InChI is InChI=1S/C16H16N2O8/c19-13-7-6-12(25-13)15(21)26-18-14(20)11(9-24-18)17-16(22)23-8-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,17,22)/t11-,12?/m1/s1.
What are the key properties of [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate?
[(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate has a molecular weight of 364.31 g/mol, XLogP of 0.22, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-3-oxo-4-(phenylmethoxycarbonylamino)-1,2-oxazolidin-2-yl] 5-oxooxolane-2-carboxylate is sourced from PubChem (CID 57324356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).