C31H26N4O6 — CID 25135837
methyl (2S,6R)-4-anilino-2,6-bis(3-nitrophenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate (PubChem CID 25135837) has the molecular formula C31H26N4O6 and a molecular weight of 550.57 g/mol. Its IUPAC name is methyl (2S,6R)-4-anilino-2,6-bis(3-nitrophenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate.
| Compound Name | methyl (2S,6R)-4-anilino-2,6-bis(3-nitrophenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 25135837 |
| Molecular Formula | C31H26N4O6 |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | methyl (2S,6R)-4-anilino-2,6-bis(3-nitrophenyl)-1-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate |
| SMILES | COC(=O)C1=C(Nc2ccccc2)C[C@@H](c2cccc([N+](=O)[O-])c2)N(c2ccccc2)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H26N4O6/c1-41-31(36)29-27(32-23-12-4-2-5-13-23)20-28(21-10-8-16-25(18-21)34(37)38)33(24-14-6-3-7-15-24)30(29)22-11-9-17-26(19-22)35(39)40/h2-19,28,30,32H,20H2,1H3/t28-,30+/m0/s1 |
| InChIKey | JZTQQEFDYZBWAJ-MFMCTBQISA-N |
| XLogP | 6.73 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|