C13H13NO6S — CID 155539547
1-[6-methyl-4-(4-nitrophenyl)-2,2-dioxo-3,4-dihydrooxathiin-5-yl]ethanone (PubChem CID 155539547) has the molecular formula C13H13NO6S and a molecular weight of 311.31 g/mol. Its IUPAC name is 1-[6-methyl-4-(4-nitrophenyl)-2,2-dioxo-3,4-dihydrooxathiin-5-yl]ethanone.
| Compound Name | 1-[6-methyl-4-(4-nitrophenyl)-2,2-dioxo-3,4-dihydrooxathiin-5-yl]ethanone |
|---|---|
| PubChem CID | 155539547 |
| Molecular Formula | C13H13NO6S |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 1-[6-methyl-4-(4-nitrophenyl)-2,2-dioxo-3,4-dihydrooxathiin-5-yl]ethanone |
| SMILES | CC(=O)C1=C(C)OS(=O)(=O)CC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H13NO6S/c1-8(15)13-9(2)20-21(18,19)7-12(13)10-3-5-11(6-4-10)14(16)17/h3-6,12H,7H2,1-2H3 |
| InChIKey | OWZTZJLGZWQZBG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|