C24H29NO6 — CID 71562176
cis-ethyl (1S,2S)-1-[(4-methylphenyl)methylcarbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate (PubChem CID 71562176) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is cis-ethyl (1S,2S)-1-[(4-methylphenyl)methylcarbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2S)-1-[(4-methylphenyl)methylcarbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 71562176 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | cis-ethyl (1S,2S)-1-[(4-methylphenyl)methylcarbamoyl]-2-(3,4,5-trimethoxyphenyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C(=O)NCc2ccc(C)cc2)C[C@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H29NO6/c1-6-31-23(27)24(22(26)25-14-16-9-7-15(2)8-10-16)13-18(24)17-11-19(28-3)21(30-5)20(12-17)29-4/h7-12,18H,6,13-14H2,1-5H3,(H,25,26)/t18-,24-/m0/s1 |
| InChIKey | RTVPASBYBBBJDN-UUOWRZLLSA-N |
| XLogP | 3.37 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|