C24H24O7 — CID 10502433
diethyl (4Z)-2-(1,3-benzodioxol-5-yl)-4-benzylideneoxolane-3,3-dicarboxylate (PubChem CID 10502433) has the molecular formula C24H24O7 and a molecular weight of 424.45 g/mol. Its IUPAC name is diethyl (4Z)-2-(1,3-benzodioxol-5-yl)-4-benzylideneoxolane-3,3-dicarboxylate.
| Compound Name | diethyl (4Z)-2-(1,3-benzodioxol-5-yl)-4-benzylideneoxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 10502433 |
| Molecular Formula | C24H24O7 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | diethyl (4Z)-2-(1,3-benzodioxol-5-yl)-4-benzylideneoxolane-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)/C(=C/c2ccccc2)COC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H24O7/c1-3-27-22(25)24(23(26)28-4-2)18(12-16-8-6-5-7-9-16)14-29-21(24)17-10-11-19-20(13-17)31-15-30-19/h5-13,21H,3-4,14-15H2,1-2H3/b18-12+ |
| InChIKey | LAIBIQMXIQNQBF-LDADJPATSA-N |
| XLogP | 3.68 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|