C25H26O8 — CID 10599813
diethyl (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(4-methoxyphenyl)methylidene]oxolane-3,3-dicarboxylate (PubChem CID 10599813) has the molecular formula C25H26O8 and a molecular weight of 454.48 g/mol. Its IUPAC name is diethyl (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(4-methoxyphenyl)methylidene]oxolane-3,3-dicarboxylate.
| Compound Name | diethyl (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(4-methoxyphenyl)methylidene]oxolane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 10599813 |
| Molecular Formula | C25H26O8 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | diethyl (4Z)-2-(1,3-benzodioxol-5-yl)-4-[(4-methoxyphenyl)methylidene]oxolane-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)/C(=C/c2ccc(OC)cc2)COC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H26O8/c1-4-29-23(26)25(24(27)30-5-2)18(12-16-6-9-19(28-3)10-7-16)14-31-22(25)17-8-11-20-21(13-17)33-15-32-20/h6-13,22H,4-5,14-15H2,1-3H3/b18-12+ |
| InChIKey | UGOLMISQPUQZEC-LDADJPATSA-N |
| XLogP | 3.69 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|