C16H13F2O7S- — CID 164777733
1,1-difluoro-2-[[4-(oxiran-2-ylmethoxy)naphthalen-1-yl]methoxy]-2-oxoethanesulfonate (PubChem CID 164777733) has the molecular formula C16H13F2O7S- and a molecular weight of 387.34 g/mol. Its IUPAC name is 1,1-difluoro-2-[[4-(oxiran-2-ylmethoxy)naphthalen-1-yl]methoxy]-2-oxoethanesulfonate.
| Compound Name | 1,1-difluoro-2-[[4-(oxiran-2-ylmethoxy)naphthalen-1-yl]methoxy]-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 164777733 |
| Molecular Formula | C16H13F2O7S- |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 1,1-difluoro-2-[[4-(oxiran-2-ylmethoxy)naphthalen-1-yl]methoxy]-2-oxoethanesulfonate |
| SMILES | O=C(OCc1ccc(OCC2CO2)c2ccccc12)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C16H14F2O7S/c17-16(18,26(20,21)22)15(19)25-7-10-5-6-14(24-9-11-8-23-11)13-4-2-1-3-12(10)13/h1-6,11H,7-9H2,(H,20,21,22)/p-1 |
| InChIKey | IRSDTFICOMXKDT-UHFFFAOYSA-M |
| XLogP | 1.80 |
| TPSA | 105.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|