C14H11F3NO6S2- — CID 164777612
[4-(oxiran-2-ylmethoxy)naphthalen-2-yl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 164777612) has the molecular formula C14H11F3NO6S2- and a molecular weight of 410.37 g/mol. Its IUPAC name is [4-(oxiran-2-ylmethoxy)naphthalen-2-yl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [4-(oxiran-2-ylmethoxy)naphthalen-2-yl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 164777612 |
| Molecular Formula | C14H11F3NO6S2- |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | [4-(oxiran-2-ylmethoxy)naphthalen-2-yl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)F)c1cc(OCC2CO2)c2ccccc2c1 |
| InChI | InChI=1S/C14H11F3NO6S2/c15-14(16,17)26(21,22)18-25(19,20)11-5-9-3-1-2-4-12(9)13(6-11)24-8-10-7-23-10/h1-6,10H,7-8H2/q-1 |
| InChIKey | GKTCPZMBSQINHE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|