C16H16O4 — CID 89326132
(2S)-2-[[3-[[(2R)-oxiran-2-yl]methoxy]naphthalen-1-yl]oxymethyl]oxirane (PubChem CID 89326132) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2S)-2-[[3-[[(2R)-oxiran-2-yl]methoxy]naphthalen-1-yl]oxymethyl]oxirane.
| Compound Name | (2S)-2-[[3-[[(2R)-oxiran-2-yl]methoxy]naphthalen-1-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 89326132 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (2S)-2-[[3-[[(2R)-oxiran-2-yl]methoxy]naphthalen-1-yl]oxymethyl]oxirane |
| SMILES | c1ccc2c(OC[C@@H]3CO3)cc(OC[C@H]3CO3)cc2c1 |
| InChI | InChI=1S/C16H16O4/c1-2-4-15-11(3-1)5-12(17-7-13-8-18-13)6-16(15)20-10-14-9-19-14/h1-6,13-14H,7-10H2/t13-,14-/m0/s1 |
| InChIKey | JLBBZRWVDMCDLV-KBPBESRZSA-N |
| XLogP | 2.39 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|