C24H34O4 — CID 177226371
ethane;[2-[2-[(E)-3-ethenylpent-3-en-2-yl]oxy-2-oxoethyl]phenyl] cyclohexanecarboxylate (PubChem CID 177226371) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is ethane;[2-[2-[(E)-3-ethenylpent-3-en-2-yl]oxy-2-oxoethyl]phenyl] cyclohexanecarboxylate.
| Compound Name | ethane;[2-[2-[(E)-3-ethenylpent-3-en-2-yl]oxy-2-oxoethyl]phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 177226371 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | ethane;[2-[2-[(E)-3-ethenylpent-3-en-2-yl]oxy-2-oxoethyl]phenyl] cyclohexanecarboxylate |
| SMILES | C=C/C(=C\C)C(C)OC(=O)Cc1ccccc1OC(=O)C1CCCCC1.CC |
| InChI | InChI=1S/C22H28O4.C2H6/c1-4-17(5-2)16(3)25-21(23)15-19-13-9-10-14-20(19)26-22(24)18-11-7-6-8-12-18;1-2/h4-5,9-10,13-14,16,18H,1,6-8,11-12,15H2,2-3H3;1-2H3/b17-5+; |
| InChIKey | BDYLLANHJWIISF-YAKHFBBESA-N |
| XLogP | 5.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|