C14H19NO3 — CID 117054327
2-[2-(2-aminocyclohexyl)oxyphenyl]acetic acid (PubChem CID 117054327) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[2-(2-aminocyclohexyl)oxyphenyl]acetic acid.
| Compound Name | 2-[2-(2-aminocyclohexyl)oxyphenyl]acetic acid |
|---|---|
| PubChem CID | 117054327 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 2-[2-(2-aminocyclohexyl)oxyphenyl]acetic acid |
| SMILES | NC1CCCCC1Oc1ccccc1CC(=O)O |
| InChI | InChI=1S/C14H19NO3/c15-11-6-2-4-8-13(11)18-12-7-3-1-5-10(12)9-14(16)17/h1,3,5,7,11,13H,2,4,6,8-9,15H2,(H,16,17) |
| InChIKey | QHRYRDCYDKHTJX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |