C16H22O3 — CID 80742277
2-[2-(3,4-dimethylcyclohexyl)oxyphenyl]acetic acid (PubChem CID 80742277) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[2-(3,4-dimethylcyclohexyl)oxyphenyl]acetic acid.
| Compound Name | 2-[2-(3,4-dimethylcyclohexyl)oxyphenyl]acetic acid |
|---|---|
| PubChem CID | 80742277 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-[2-(3,4-dimethylcyclohexyl)oxyphenyl]acetic acid |
| SMILES | CC1CCC(Oc2ccccc2CC(=O)O)CC1C |
| InChI | InChI=1S/C16H22O3/c1-11-7-8-14(9-12(11)2)19-15-6-4-3-5-13(15)10-16(17)18/h3-6,11-12,14H,7-10H2,1-2H3,(H,17,18) |
| InChIKey | QEIBCESCGQDEFV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |