C14H19BF3KO — CID 64738388
potassium [2-(3,4-dimethylcyclohexyl)oxyphenyl]-trifluoroboranuide (PubChem CID 64738388) has the molecular formula C14H19BF3KO and a molecular weight of 310.21 g/mol. Its IUPAC name is potassium [2-(3,4-dimethylcyclohexyl)oxyphenyl]-trifluoroboranuide.
| Compound Name | potassium [2-(3,4-dimethylcyclohexyl)oxyphenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 64738388 |
| Molecular Formula | C14H19BF3KO |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | potassium [2-(3,4-dimethylcyclohexyl)oxyphenyl]-trifluoroboranuide |
| SMILES | CC1CCC(Oc2ccccc2[B-](F)(F)F)CC1C.[K+] |
| InChI | InChI=1S/C14H19BF3O.K/c1-10-7-8-12(9-11(10)2)19-14-6-4-3-5-13(14)15(16,17)18;/h3-6,10-12H,7-9H2,1-2H3;/q-1;+1 |
| InChIKey | LZVASWBEMAKDBU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|