C14H18BF4O- — CID 64738793
[2-(3,4-dimethylcyclohexyl)oxy-5-fluorophenyl]-trifluoroboranuide (PubChem CID 64738793) has the molecular formula C14H18BF4O- and a molecular weight of 289.10 g/mol. Its IUPAC name is [2-(3,4-dimethylcyclohexyl)oxy-5-fluorophenyl]-trifluoroboranuide.
| Compound Name | [2-(3,4-dimethylcyclohexyl)oxy-5-fluorophenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 64738793 |
| Molecular Formula | C14H18BF4O- |
| Molecular Weight | 289.10 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | [2-(3,4-dimethylcyclohexyl)oxy-5-fluorophenyl]-trifluoroboranuide |
| SMILES | CC1CCC(Oc2ccc(F)cc2[B-](F)(F)F)CC1C |
| InChI | InChI=1S/C14H18BF4O/c1-9-3-5-12(7-10(9)2)20-14-6-4-11(16)8-13(14)15(17,18)19/h4,6,8-10,12H,3,5,7H2,1-2H3/q-1 |
| InChIKey | BGTJGVREFQFYNJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.10 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|