C26H28O6 — CID 54538839
bis[(2-acetylphenyl)methyl] cyclohexane-1,3-dicarboxylate (PubChem CID 54538839) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is bis[(2-acetylphenyl)methyl] cyclohexane-1,3-dicarboxylate.
| Compound Name | bis[(2-acetylphenyl)methyl] cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 54538839 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | bis[(2-acetylphenyl)methyl] cyclohexane-1,3-dicarboxylate |
| SMILES | CC(=O)c1ccccc1COC(=O)C1CCCC(C(=O)OCc2ccccc2C(C)=O)C1 |
| InChI | InChI=1S/C26H28O6/c1-17(27)23-12-5-3-8-21(23)15-31-25(29)19-10-7-11-20(14-19)26(30)32-16-22-9-4-6-13-24(22)18(2)28/h3-6,8-9,12-13,19-20H,7,10-11,14-16H2,1-2H3 |
| InChIKey | ZBROJEWNCASOKC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |