C17H20N2O4 — CID 82253908
3-[(3,4,5-trimethoxyphenyl)methoxy]benzenecarboximidamide (PubChem CID 82253908) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-[(3,4,5-trimethoxyphenyl)methoxy]benzenecarboximidamide.
| Compound Name | 3-[(3,4,5-trimethoxyphenyl)methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 82253908 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-[(3,4,5-trimethoxyphenyl)methoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(OCc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C17H20N2O4/c1-20-14-7-11(8-15(21-2)16(14)22-3)10-23-13-6-4-5-12(9-13)17(18)19/h4-9H,10H2,1-3H3,(H3,18,19) |
| InChIKey | SNWZYAKOSSGZIL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|