C34H42N4O6 — CID 10234367
N,N'-diethyl-N,N'-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine (PubChem CID 10234367) has the molecular formula C34H42N4O6 and a molecular weight of 602.73 g/mol. Its IUPAC name is N,N'-diethyl-N,N'-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine.
| Compound Name | N,N'-diethyl-N,N'-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 10234367 |
| Molecular Formula | C34H42N4O6 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | N,N'-diethyl-N,N'-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine |
| SMILES | CCN(CCN(CC)c1ccc(-c2cc(OC)c(OC)c(OC)c2)nc1)c1ccc(-c2cc(OC)c(OC)c(OC)c2)nc1 |
| InChI | InChI=1S/C34H42N4O6/c1-9-37(25-11-13-27(35-21-25)23-17-29(39-3)33(43-7)30(18-23)40-4)15-16-38(10-2)26-12-14-28(36-22-26)24-19-31(41-5)34(44-8)32(20-24)42-6/h11-14,17-22H,9-10,15-16H2,1-8H3 |
| InChIKey | NBHOHNOUBNXZET-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 87.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |