C36H46N4O13S2 — CID 90685560
2-[2-[methyl-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]amino]ethoxy]-2-[[methyl-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]amino]methyl]propane-1,3-disulfonic acid (PubChem CID 90685560) has the molecular formula C36H46N4O13S2 and a molecular weight of 806.91 g/mol. Its IUPAC name is 2-[2-[methyl-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]amino]ethoxy]-2-[[methyl-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]amino]methyl]propane-1,3-disulfonic acid.
| Compound Name | 2-[2-[methyl-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]amino]ethoxy]-2-[[methyl-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]amino]methyl]propane-1,3-disulfonic acid |
|---|---|
| PubChem CID | 90685560 |
| Molecular Formula | C36H46N4O13S2 |
| Molecular Weight | 806.91 g/mol |
| Exact Mass | 806.25 |
| IUPAC Name | 2-[2-[methyl-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]amino]ethoxy]-2-[[methyl-[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]amino]methyl]propane-1,3-disulfonic acid |
| SMILES | COc1cc(-c2ccc(N(C)CCOC(CN(C)c3ccc(-c4cc(OC)c(OC)c(OC)c4)nc3)(CS(=O)(=O)O)CS(=O)(=O)O)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C36H46N4O13S2/c1-39(26-9-11-28(37-19-26)24-15-30(47-3)34(51-7)31(16-24)48-4)13-14-53-36(22-54(41,42)43,23-55(44,45)46)21-40(2)27-10-12-29(38-20-27)25-17-32(49-5)35(52-8)33(18-25)50-6/h9-12,15-20H,13-14,21-23H2,1-8H3,(H,41,42,43)(H,44,45,46) |
| InChIKey | OVRAAXUKQZTCHL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 205.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|