C34H40N4O6 — CID 69353809
2-N,2-N-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]cyclohexane-1,2-diamine (PubChem CID 69353809) has the molecular formula C34H40N4O6 and a molecular weight of 600.72 g/mol. Its IUPAC name is 2-N,2-N-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]cyclohexane-1,2-diamine.
| Compound Name | 2-N,2-N-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 69353809 |
| Molecular Formula | C34H40N4O6 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 2-N,2-N-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]cyclohexane-1,2-diamine |
| SMILES | COc1cc(-c2ccc(N(c3ccc(-c4cc(OC)c(OC)c(OC)c4)nc3)C3CCCCC3N)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C34H40N4O6/c1-39-29-15-21(16-30(40-2)33(29)43-5)26-13-11-23(19-36-26)38(28-10-8-7-9-25(28)35)24-12-14-27(37-20-24)22-17-31(41-3)34(44-6)32(18-22)42-4/h11-20,25,28H,7-10,35H2,1-6H3 |
| InChIKey | HTUOOLKUQDMDTD-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |