C32H36N4O6 — CID 22485481
1,4-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]piperazine (PubChem CID 22485481) has the molecular formula C32H36N4O6 and a molecular weight of 572.66 g/mol. Its IUPAC name is 1,4-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]piperazine.
| Compound Name | 1,4-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]piperazine |
|---|---|
| PubChem CID | 22485481 |
| Molecular Formula | C32H36N4O6 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 1,4-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]piperazine |
| SMILES | COc1cc(-c2ccc(N3CCN(c4ccc(-c5cc(OC)c(OC)c(OC)c5)nc4)CC3)cn2)cc(OC)c1OC |
| InChI | InChI=1S/C32H36N4O6/c1-37-27-15-21(16-28(38-2)31(27)41-5)25-9-7-23(19-33-25)35-11-13-36(14-12-35)24-8-10-26(34-20-24)22-17-29(39-3)32(42-6)30(18-22)40-4/h7-10,15-20H,11-14H2,1-6H3 |
| InChIKey | FPIOOGPQGVRECV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 87.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |