3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid

C17H17BrO4 — CID 20989563

IUPAC3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid
SMILESCOc1cc(CC(C(=O)O)c2ccccc2)cc(Br)c1OC
InChIInChI=1S/C17H17BrO4/c1-21-15-10-11(9-14(18)16(15)22-2)8-13(17(19)20)12-6-4-3-5-7-12/h3-7,9-10,13H,8H2,1-2H3,(H,19,20)
InChIKeyGLXRUVIEGDRGOY-UHFFFAOYSA-N
MW365.22 g/mol
LogP3.88
Rot. Bonds6

About 3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid

3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid (PubChem CID 20989563) has the molecular formula C17H17BrO4 and a molecular weight of 365.22 g/mol. Its IUPAC name is 3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid.

Molecular Properties

Compound Name3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid
PubChem CID20989563
Molecular FormulaC17H17BrO4
Molecular Weight365.22 g/mol
Exact Mass364.03
IUPAC Name3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid
SMILESCOc1cc(CC(C(=O)O)c2ccccc2)cc(Br)c1OC
InChIInChI=1S/C17H17BrO4/c1-21-15-10-11(9-14(18)16(15)22-2)8-13(17(19)20)12-6-4-3-5-7-12/h3-7,9-10,13H,8H2,1-2H3,(H,19,20)
InChIKeyGLXRUVIEGDRGOY-UHFFFAOYSA-N
XLogP3.88
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500365.22
LogP ≤ 53.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid?
The IUPAC name of 3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid (CID 20989563) is 3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid.
What is the SMILES notation for 3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid?
The canonical SMILES for 3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid is COc1cc(CC(C(=O)O)c2ccccc2)cc(Br)c1OC.
What is the InChIKey of 3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid?
The InChIKey is GLXRUVIEGDRGOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrO4/c1-21-15-10-11(9-14(18)16(15)22-2)8-13(17(19)20)12-6-4-3-5-7-12/h3-7,9-10,13H,8H2,1-2H3,(H,19,20).
What are the key properties of 3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid?
3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid has a molecular weight of 365.22 g/mol, XLogP of 3.88, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromo-4,5-dimethoxyphenyl)-2-phenylpropanoic acid is sourced from PubChem (CID 20989563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).