C12H18O4 — CID 170887561
3-[2-(hydroxymethyl)-4,6-dimethoxyphenyl]propan-1-ol (PubChem CID 170887561) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)-4,6-dimethoxyphenyl]propan-1-ol.
| Compound Name | 3-[2-(hydroxymethyl)-4,6-dimethoxyphenyl]propan-1-ol |
|---|---|
| PubChem CID | 170887561 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-[2-(hydroxymethyl)-4,6-dimethoxyphenyl]propan-1-ol |
| SMILES | COc1cc(CO)c(CCCO)c(OC)c1 |
| InChI | InChI=1S/C12H18O4/c1-15-10-6-9(8-14)11(4-3-5-13)12(7-10)16-2/h6-7,13-14H,3-5,8H2,1-2H3 |
| InChIKey | GZLZMMYONZSRDE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |