C11H16O4S — CID 129121161
(2,4,6-trimethoxyphenyl)methylsulfanylmethanol (PubChem CID 129121161) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is (2,4,6-trimethoxyphenyl)methylsulfanylmethanol.
| Compound Name | (2,4,6-trimethoxyphenyl)methylsulfanylmethanol |
|---|---|
| PubChem CID | 129121161 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | (2,4,6-trimethoxyphenyl)methylsulfanylmethanol |
| SMILES | COc1cc(OC)c(CSCO)c(OC)c1 |
| InChI | InChI=1S/C11H16O4S/c1-13-8-4-10(14-2)9(6-16-7-12)11(5-8)15-3/h4-5,12H,6-7H2,1-3H3 |
| InChIKey | NPNJPCBWCYGWDE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|