C18H27NO5S — CID 11303174
S-[(2,4,6-trimethoxyphenyl)methyl] (2S)-2-acetamido-4-methylpentanethioate (PubChem CID 11303174) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is S-[(2,4,6-trimethoxyphenyl)methyl] (2S)-2-acetamido-4-methylpentanethioate.
| Compound Name | S-[(2,4,6-trimethoxyphenyl)methyl] (2S)-2-acetamido-4-methylpentanethioate |
|---|---|
| PubChem CID | 11303174 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | S-[(2,4,6-trimethoxyphenyl)methyl] (2S)-2-acetamido-4-methylpentanethioate |
| SMILES | COc1cc(OC)c(CSC(=O)[C@H](CC(C)C)NC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C18H27NO5S/c1-11(2)7-15(19-12(3)20)18(21)25-10-14-16(23-5)8-13(22-4)9-17(14)24-6/h8-9,11,15H,7,10H2,1-6H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | MFOPDXUSMCTOCX-HNNXBMFYSA-N |
| XLogP | 3.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|