C17H27NO5 — CID 174673868
1,2-dimethoxybenzene;methyl 2-acetamido-4-methylpentanoate (PubChem CID 174673868) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1,2-dimethoxybenzene;methyl 2-acetamido-4-methylpentanoate.
| Compound Name | 1,2-dimethoxybenzene;methyl 2-acetamido-4-methylpentanoate |
|---|---|
| PubChem CID | 174673868 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1,2-dimethoxybenzene;methyl 2-acetamido-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(C)=O.COc1ccccc1OC |
| InChI | InChI=1S/C9H17NO3.C8H10O2/c1-6(2)5-8(9(12)13-4)10-7(3)11;1-9-7-5-3-4-6-8(7)10-2/h6,8H,5H2,1-4H3,(H,10,11);3-6H,1-2H3 |
| InChIKey | VRWSMOXWIHPDDW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |