C14H20O4 — CID 116928893
[1-[(2,4,6-trimethoxyphenyl)methyl]cyclopropyl]methanol (PubChem CID 116928893) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is [1-[(2,4,6-trimethoxyphenyl)methyl]cyclopropyl]methanol.
| Compound Name | [1-[(2,4,6-trimethoxyphenyl)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 116928893 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [1-[(2,4,6-trimethoxyphenyl)methyl]cyclopropyl]methanol |
| SMILES | COc1cc(OC)c(CC2(CO)CC2)c(OC)c1 |
| InChI | InChI=1S/C14H20O4/c1-16-10-6-12(17-2)11(13(7-10)18-3)8-14(9-15)4-5-14/h6-7,15H,4-5,8-9H2,1-3H3 |
| InChIKey | QNUNAKIJMUDKSR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |