C28H36O9P+ — CID 140870637
bis[2-(hydroxymethyl)-4,6-dimethoxyphenyl]-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-methylphosphanium (PubChem CID 140870637) has the molecular formula C28H36O9P+ and a molecular weight of 547.56 g/mol. Its IUPAC name is bis[2-(hydroxymethyl)-4,6-dimethoxyphenyl]-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-methylphosphanium.
| Compound Name | bis[2-(hydroxymethyl)-4,6-dimethoxyphenyl]-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-methylphosphanium |
|---|---|
| PubChem CID | 140870637 |
| Molecular Formula | C28H36O9P+ |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | bis[2-(hydroxymethyl)-4,6-dimethoxyphenyl]-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-methylphosphanium |
| SMILES | COc1cc(CO)c([P+](C)(c2c(CO)cc(OC)cc2OC)c2c(OC)cc(CO)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C28H36O9P/c1-32-20-10-18(15-30)26(24(12-20)36-5)38(7,27-19(16-31)11-21(33-2)13-25(27)37-6)28-22(34-3)8-17(14-29)9-23(28)35-4/h8-13,29-31H,14-16H2,1-7H3/q+1 |
| InChIKey | SGUOKJJSTOFOBV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|