C12H20N2O2 — CID 23346964
3-(aminomethyl)-4,5-dimethoxy-2-propylaniline (PubChem CID 23346964) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-(aminomethyl)-4,5-dimethoxy-2-propylaniline.
| Compound Name | 3-(aminomethyl)-4,5-dimethoxy-2-propylaniline |
|---|---|
| PubChem CID | 23346964 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-(aminomethyl)-4,5-dimethoxy-2-propylaniline |
| SMILES | CCCc1c(N)cc(OC)c(OC)c1CN |
| InChI | InChI=1S/C12H20N2O2/c1-4-5-8-9(7-13)12(16-3)11(15-2)6-10(8)14/h6H,4-5,7,13-14H2,1-3H3 |
| InChIKey | GUYQKPXLQCFTAZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|