About 4-hydroxy-3,5-dimethoxy-2-propylbenzamide
4-hydroxy-3,5-dimethoxy-2-propylbenzamide (PubChem CID 166451177) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is 4-hydroxy-3,5-dimethoxy-2-propylbenzamide.
Molecular Properties
| Compound Name | 4-hydroxy-3,5-dimethoxy-2-propylbenzamide |
| PubChem CID | 166451177 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 4-hydroxy-3,5-dimethoxy-2-propylbenzamide |
| SMILES | CCCc1c(C(N)=O)cc(OC)c(O)c1OC |
| InChI | InChI=1S/C12H17NO4/c1-4-5-7-8(12(13)15)6-9(16-2)10(14)11(7)17-3/h6,14H,4-5H2,1-3H3,(H2,13,15) |
| InChIKey | KXERJWBVGNPYBX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-3,5-dimethoxy-2-propylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3,5-dimethoxy-2-propylbenzamide?
The IUPAC name of 4-hydroxy-3,5-dimethoxy-2-propylbenzamide (CID 166451177) is 4-hydroxy-3,5-dimethoxy-2-propylbenzamide.
What is the SMILES notation for 4-hydroxy-3,5-dimethoxy-2-propylbenzamide?
The canonical SMILES for 4-hydroxy-3,5-dimethoxy-2-propylbenzamide is CCCc1c(C(N)=O)cc(OC)c(O)c1OC.
What is the InChIKey of 4-hydroxy-3,5-dimethoxy-2-propylbenzamide?
The InChIKey is KXERJWBVGNPYBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4/c1-4-5-7-8(12(13)15)6-9(16-2)10(14)11(7)17-3/h6,14H,4-5H2,1-3H3,(H2,13,15).
What are the key properties of 4-hydroxy-3,5-dimethoxy-2-propylbenzamide?
4-hydroxy-3,5-dimethoxy-2-propylbenzamide has a molecular weight of 239.27 g/mol, XLogP of 1.46, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3,5-dimethoxy-2-propylbenzamide is sourced from PubChem (CID 166451177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).